C13H15F2NO3 — CID 2515239
[2-(tert-butylamino)-2-oxoethyl] 2,6-difluorobenzoate (PubChem CID 2515239) has the molecular formula C13H15F2NO3 and a molecular weight of 271.26 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl] 2,6-difluorobenzoate.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl] 2,6-difluorobenzoate |
|---|---|
| PubChem CID | 2515239 |
| Molecular Formula | C13H15F2NO3 |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl] 2,6-difluorobenzoate |
| SMILES | CC(C)(C)NC(=O)COC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C13H15F2NO3/c1-13(2,3)16-10(17)7-19-12(18)11-8(14)5-4-6-9(11)15/h4-6H,7H2,1-3H3,(H,16,17) |
| InChIKey | VOPMVKCPQOIBFB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |