C16H19FN2O3S2 — CID 40817445
N-[(3R)-1,1-dioxothiolan-3-yl]-4-fluoro-N',N',3-trimethyl-1-benzothiophene-2-carbohydrazide (PubChem CID 40817445) has the molecular formula C16H19FN2O3S2 and a molecular weight of 370.47 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-4-fluoro-N',N',3-trimethyl-1-benzothiophene-2-carbohydrazide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-4-fluoro-N',N',3-trimethyl-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 40817445 |
| Molecular Formula | C16H19FN2O3S2 |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-4-fluoro-N',N',3-trimethyl-1-benzothiophene-2-carbohydrazide |
| SMILES | Cc1c(C(=O)N([C@@H]2CCS(=O)(=O)C2)N(C)C)sc2cccc(F)c12 |
| InChI | InChI=1S/C16H19FN2O3S2/c1-10-14-12(17)5-4-6-13(14)23-15(10)16(20)19(18(2)3)11-7-8-24(21,22)9-11/h4-6,11H,7-9H2,1-3H3/t11-/m1/s1 |
| InChIKey | NBFPFIGBUIJKEK-LLVKDONJSA-N |
| XLogP | 2.45 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|