C13H16Cl2N2O3S — CID 40842810
3,5-dichloro-N-[(3S)-1,1-dioxothiolan-3-yl]-N',N'-dimethylbenzohydrazide (PubChem CID 40842810) has the molecular formula C13H16Cl2N2O3S and a molecular weight of 351.26 g/mol. Its IUPAC name is 3,5-dichloro-N-[(3S)-1,1-dioxothiolan-3-yl]-N',N'-dimethylbenzohydrazide.
| Compound Name | 3,5-dichloro-N-[(3S)-1,1-dioxothiolan-3-yl]-N',N'-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 40842810 |
| Molecular Formula | C13H16Cl2N2O3S |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 3,5-dichloro-N-[(3S)-1,1-dioxothiolan-3-yl]-N',N'-dimethylbenzohydrazide |
| SMILES | CN(C)N(C(=O)c1cc(Cl)cc(Cl)c1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H16Cl2N2O3S/c1-16(2)17(12-3-4-21(19,20)8-12)13(18)9-5-10(14)7-11(15)6-9/h5-7,12H,3-4,8H2,1-2H3/t12-/m0/s1 |
| InChIKey | ZULJIEPMCRYCSN-LBPRGKRZSA-N |
| XLogP | 2.10 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|