C12H14Cl2N2O3S — CID 61102704
3-amino-4,5-dichloro-N-(1,1-dioxothiolan-3-yl)-N-methylbenzamide (PubChem CID 61102704) has the molecular formula C12H14Cl2N2O3S and a molecular weight of 337.23 g/mol. Its IUPAC name is 3-amino-4,5-dichloro-N-(1,1-dioxothiolan-3-yl)-N-methylbenzamide.
| Compound Name | 3-amino-4,5-dichloro-N-(1,1-dioxothiolan-3-yl)-N-methylbenzamide |
|---|---|
| PubChem CID | 61102704 |
| Molecular Formula | C12H14Cl2N2O3S |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 3-amino-4,5-dichloro-N-(1,1-dioxothiolan-3-yl)-N-methylbenzamide |
| SMILES | CN(C(=O)c1cc(N)c(Cl)c(Cl)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H14Cl2N2O3S/c1-16(8-2-3-20(18,19)6-8)12(17)7-4-9(13)11(14)10(15)5-7/h4-5,8H,2-3,6,15H2,1H3 |
| InChIKey | KTANHESOVBKCOZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|