C19H18FNOS — CID 9457233
4-fluoro-3-methyl-N-[(2S)-2-phenylpropyl]-1-benzothiophene-2-carboxamide (PubChem CID 9457233) has the molecular formula C19H18FNOS and a molecular weight of 327.42 g/mol. Its IUPAC name is 4-fluoro-3-methyl-N-[(2S)-2-phenylpropyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 4-fluoro-3-methyl-N-[(2S)-2-phenylpropyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 9457233 |
| Molecular Formula | C19H18FNOS |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 4-fluoro-3-methyl-N-[(2S)-2-phenylpropyl]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1c(C(=O)NC[C@@H](C)c2ccccc2)sc2cccc(F)c12 |
| InChI | InChI=1S/C19H18FNOS/c1-12(14-7-4-3-5-8-14)11-21-19(22)18-13(2)17-15(20)9-6-10-16(17)23-18/h3-10,12H,11H2,1-2H3,(H,21,22)/t12-/m1/s1 |
| InChIKey | JQVYURIQNZLOJQ-GFCCVEGCSA-N |
| XLogP | 4.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |