C15H16FNO3S — CID 107564324
(2S)-2-[(4-fluoro-3-methyl-1-benzothiophene-2-carbonyl)amino]pentanoic acid (PubChem CID 107564324) has the molecular formula C15H16FNO3S and a molecular weight of 309.36 g/mol. Its IUPAC name is (2S)-2-[(4-fluoro-3-methyl-1-benzothiophene-2-carbonyl)amino]pentanoic acid.
| Compound Name | (2S)-2-[(4-fluoro-3-methyl-1-benzothiophene-2-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 107564324 |
| Molecular Formula | C15H16FNO3S |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | (2S)-2-[(4-fluoro-3-methyl-1-benzothiophene-2-carbonyl)amino]pentanoic acid |
| SMILES | CCC[C@H](NC(=O)c1sc2cccc(F)c2c1C)C(=O)O |
| InChI | InChI=1S/C15H16FNO3S/c1-3-5-10(15(19)20)17-14(18)13-8(2)12-9(16)6-4-7-11(12)21-13/h4,6-7,10H,3,5H2,1-2H3,(H,17,18)(H,19,20)/t10-/m0/s1 |
| InChIKey | HUZCFYWHJPSOCS-JTQLQIEISA-N |
| XLogP | 3.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |