C14H14FNO4S — CID 43408404
methyl 2-[(4-fluoro-3-methyl-1-benzothiophene-2-carbonyl)amino]-3-hydroxypropanoate (PubChem CID 43408404) has the molecular formula C14H14FNO4S and a molecular weight of 311.33 g/mol. Its IUPAC name is methyl 2-[(4-fluoro-3-methyl-1-benzothiophene-2-carbonyl)amino]-3-hydroxypropanoate.
| Compound Name | methyl 2-[(4-fluoro-3-methyl-1-benzothiophene-2-carbonyl)amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 43408404 |
| Molecular Formula | C14H14FNO4S |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | methyl 2-[(4-fluoro-3-methyl-1-benzothiophene-2-carbonyl)amino]-3-hydroxypropanoate |
| SMILES | COC(=O)C(CO)NC(=O)c1sc2cccc(F)c2c1C |
| InChI | InChI=1S/C14H14FNO4S/c1-7-11-8(15)4-3-5-10(11)21-12(7)13(18)16-9(6-17)14(19)20-2/h3-5,9,17H,6H2,1-2H3,(H,16,18) |
| InChIKey | DDRRZGULXIVGPA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |