C15H18FNO3S — CID 103877257
4-fluoro-N-(3-hydroxy-4-methoxybutyl)-3-methyl-1-benzothiophene-2-carboxamide (PubChem CID 103877257) has the molecular formula C15H18FNO3S and a molecular weight of 311.38 g/mol. Its IUPAC name is 4-fluoro-N-(3-hydroxy-4-methoxybutyl)-3-methyl-1-benzothiophene-2-carboxamide.
| Compound Name | 4-fluoro-N-(3-hydroxy-4-methoxybutyl)-3-methyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 103877257 |
| Molecular Formula | C15H18FNO3S |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 4-fluoro-N-(3-hydroxy-4-methoxybutyl)-3-methyl-1-benzothiophene-2-carboxamide |
| SMILES | COCC(O)CCNC(=O)c1sc2cccc(F)c2c1C |
| InChI | InChI=1S/C15H18FNO3S/c1-9-13-11(16)4-3-5-12(13)21-14(9)15(19)17-7-6-10(18)8-20-2/h3-5,10,18H,6-8H2,1-2H3,(H,17,19) |
| InChIKey | JXPDEQDQWDPEPG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |