C21H22FNO3S — CID 55716873
N-[2-(2,6-dimethylphenoxy)ethyl]-4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxamide (PubChem CID 55716873) has the molecular formula C21H22FNO3S and a molecular weight of 387.48 g/mol. Its IUPAC name is N-[2-(2,6-dimethylphenoxy)ethyl]-4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | N-[2-(2,6-dimethylphenoxy)ethyl]-4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 55716873 |
| Molecular Formula | C21H22FNO3S |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-[2-(2,6-dimethylphenoxy)ethyl]-4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxamide |
| SMILES | COCc1c(C(=O)NCCOc2c(C)cccc2C)sc2cccc(F)c12 |
| InChI | InChI=1S/C21H22FNO3S/c1-13-6-4-7-14(2)19(13)26-11-10-23-21(24)20-15(12-25-3)18-16(22)8-5-9-17(18)27-20/h4-9H,10-12H2,1-3H3,(H,23,24) |
| InChIKey | HQXBGMIXHLZHMM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|