C20H20FNO3S — CID 24538284
4-fluoro-3-(methoxymethyl)-N-[2-(4-methoxyphenyl)ethyl]-1-benzothiophene-2-carboxamide (PubChem CID 24538284) has the molecular formula C20H20FNO3S and a molecular weight of 373.45 g/mol. Its IUPAC name is 4-fluoro-3-(methoxymethyl)-N-[2-(4-methoxyphenyl)ethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 4-fluoro-3-(methoxymethyl)-N-[2-(4-methoxyphenyl)ethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 24538284 |
| Molecular Formula | C20H20FNO3S |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 4-fluoro-3-(methoxymethyl)-N-[2-(4-methoxyphenyl)ethyl]-1-benzothiophene-2-carboxamide |
| SMILES | COCc1c(C(=O)NCCc2ccc(OC)cc2)sc2cccc(F)c12 |
| InChI | InChI=1S/C20H20FNO3S/c1-24-12-15-18-16(21)4-3-5-17(18)26-19(15)20(23)22-11-10-13-6-8-14(25-2)9-7-13/h3-9H,10-12H2,1-2H3,(H,22,23) |
| InChIKey | ZTFRATGWAPPFFK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |