C18H16FNO3S — CID 27666393
4-fluoro-3-(methoxymethyl)-N-(3-methoxyphenyl)-1-benzothiophene-2-carboxamide (PubChem CID 27666393) has the molecular formula C18H16FNO3S and a molecular weight of 345.40 g/mol. Its IUPAC name is 4-fluoro-3-(methoxymethyl)-N-(3-methoxyphenyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 4-fluoro-3-(methoxymethyl)-N-(3-methoxyphenyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 27666393 |
| Molecular Formula | C18H16FNO3S |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 4-fluoro-3-(methoxymethyl)-N-(3-methoxyphenyl)-1-benzothiophene-2-carboxamide |
| SMILES | COCc1c(C(=O)Nc2cccc(OC)c2)sc2cccc(F)c12 |
| InChI | InChI=1S/C18H16FNO3S/c1-22-10-13-16-14(19)7-4-8-15(16)24-17(13)18(21)20-11-5-3-6-12(9-11)23-2/h3-9H,10H2,1-2H3,(H,20,21) |
| InChIKey | XQBGSSONVLILNB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |