C18H15BrFNO2S — CID 27667992
N-(2-bromo-4-methylphenyl)-4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxamide (PubChem CID 27667992) has the molecular formula C18H15BrFNO2S and a molecular weight of 408.29 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 27667992 |
| Molecular Formula | C18H15BrFNO2S |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.00 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxamide |
| SMILES | COCc1c(C(=O)Nc2ccc(C)cc2Br)sc2cccc(F)c12 |
| InChI | InChI=1S/C18H15BrFNO2S/c1-10-6-7-14(12(19)8-10)21-18(22)17-11(9-23-2)16-13(20)4-3-5-15(16)24-17/h3-8H,9H2,1-2H3,(H,21,22) |
| InChIKey | SZXHGRMMVIAYSM-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |