C21H22FNO3S — CID 55902863
4-fluoro-3-(methoxymethyl)-N-(4-methyl-2-propoxyphenyl)-1-benzothiophene-2-carboxamide (PubChem CID 55902863) has the molecular formula C21H22FNO3S and a molecular weight of 387.48 g/mol. Its IUPAC name is 4-fluoro-3-(methoxymethyl)-N-(4-methyl-2-propoxyphenyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 4-fluoro-3-(methoxymethyl)-N-(4-methyl-2-propoxyphenyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 55902863 |
| Molecular Formula | C21H22FNO3S |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 4-fluoro-3-(methoxymethyl)-N-(4-methyl-2-propoxyphenyl)-1-benzothiophene-2-carboxamide |
| SMILES | CCCOc1cc(C)ccc1NC(=O)c1sc2cccc(F)c2c1COC |
| InChI | InChI=1S/C21H22FNO3S/c1-4-10-26-17-11-13(2)8-9-16(17)23-21(24)20-14(12-25-3)19-15(22)6-5-7-18(19)27-20/h5-9,11H,4,10,12H2,1-3H3,(H,23,24) |
| InChIKey | IVDALPJDVYOZGL-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |