C26H32FN3O2S — CID 55933270
N-[4-(4-benzylpiperazin-1-yl)butyl]-4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxamide (PubChem CID 55933270) has the molecular formula C26H32FN3O2S and a molecular weight of 469.63 g/mol. Its IUPAC name is N-[4-(4-benzylpiperazin-1-yl)butyl]-4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | N-[4-(4-benzylpiperazin-1-yl)butyl]-4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 55933270 |
| Molecular Formula | C26H32FN3O2S |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | N-[4-(4-benzylpiperazin-1-yl)butyl]-4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxamide |
| SMILES | COCc1c(C(=O)NCCCCN2CCN(Cc3ccccc3)CC2)sc2cccc(F)c12 |
| InChI | InChI=1S/C26H32FN3O2S/c1-32-19-21-24-22(27)10-7-11-23(24)33-25(21)26(31)28-12-5-6-13-29-14-16-30(17-15-29)18-20-8-3-2-4-9-20/h2-4,7-11H,5-6,12-19H2,1H3,(H,28,31) |
| InChIKey | WDLWXDAYRNMNJZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|