C12H15BrFNO3 — CID 106243511
2-bromo-3-fluoro-N-(3-hydroxy-4-methoxybutyl)benzamide (PubChem CID 106243511) has the molecular formula C12H15BrFNO3 and a molecular weight of 320.16 g/mol. Its IUPAC name is 2-bromo-3-fluoro-N-(3-hydroxy-4-methoxybutyl)benzamide.
| Compound Name | 2-bromo-3-fluoro-N-(3-hydroxy-4-methoxybutyl)benzamide |
|---|---|
| PubChem CID | 106243511 |
| Molecular Formula | C12H15BrFNO3 |
| Molecular Weight | 320.16 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 2-bromo-3-fluoro-N-(3-hydroxy-4-methoxybutyl)benzamide |
| SMILES | COCC(O)CCNC(=O)c1cccc(F)c1Br |
| InChI | InChI=1S/C12H15BrFNO3/c1-18-7-8(16)5-6-15-12(17)9-3-2-4-10(14)11(9)13/h2-4,8,16H,5-7H2,1H3,(H,15,17) |
| InChIKey | PWNMZXPFGXCWKU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.16 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |