C12H12F5NO3 — CID 106243310
2,3,4,5,6-pentafluoro-N-(3-hydroxy-4-methoxybutyl)benzamide (PubChem CID 106243310) has the molecular formula C12H12F5NO3 and a molecular weight of 313.22 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-(3-hydroxy-4-methoxybutyl)benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-(3-hydroxy-4-methoxybutyl)benzamide |
|---|---|
| PubChem CID | 106243310 |
| Molecular Formula | C12H12F5NO3 |
| Molecular Weight | 313.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-(3-hydroxy-4-methoxybutyl)benzamide |
| SMILES | COCC(O)CCNC(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H12F5NO3/c1-21-4-5(19)2-3-18-12(20)6-7(13)9(15)11(17)10(16)8(6)14/h5,19H,2-4H2,1H3,(H,18,20) |
| InChIKey | XNLLBZQYAFGMNK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.22 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|