C15H15F2I3NO6S- — CID 167388432
2-[4-[ethyl-(2,3,5-triiodobenzoyl)amino]butanoyloxy]-1,1-difluoroethanesulfonate (PubChem CID 167388432) has the molecular formula C15H15F2I3NO6S- and a molecular weight of 756.06 g/mol. Its IUPAC name is 2-[4-[ethyl-(2,3,5-triiodobenzoyl)amino]butanoyloxy]-1,1-difluoroethanesulfonate.
| Compound Name | 2-[4-[ethyl-(2,3,5-triiodobenzoyl)amino]butanoyloxy]-1,1-difluoroethanesulfonate |
|---|---|
| PubChem CID | 167388432 |
| Molecular Formula | C15H15F2I3NO6S- |
| Molecular Weight | 756.06 g/mol |
| Exact Mass | 755.77 |
| IUPAC Name | 2-[4-[ethyl-(2,3,5-triiodobenzoyl)amino]butanoyloxy]-1,1-difluoroethanesulfonate |
| SMILES | CCN(CCCC(=O)OCC(F)(F)S(=O)(=O)[O-])C(=O)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C15H16F2I3NO6S/c1-2-21(14(23)10-6-9(18)7-11(19)13(10)20)5-3-4-12(22)27-8-15(16,17)28(24,25)26/h6-7H,2-5,8H2,1H3,(H,24,25,26)/p-1 |
| InChIKey | UIDWSAHLWCAALF-UHFFFAOYSA-M |
| XLogP | 3.42 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.06 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|