C7H11F2O5S- — CID 59185150
1,1-difluoro-2-pentanoyloxyethanesulfonate (PubChem CID 59185150) has the molecular formula C7H11F2O5S- and a molecular weight of 245.22 g/mol. Its IUPAC name is 1,1-difluoro-2-pentanoyloxyethanesulfonate.
| Compound Name | 1,1-difluoro-2-pentanoyloxyethanesulfonate |
|---|---|
| PubChem CID | 59185150 |
| Molecular Formula | C7H11F2O5S- |
| Molecular Weight | 245.22 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 1,1-difluoro-2-pentanoyloxyethanesulfonate |
| SMILES | CCCCC(=O)OCC(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C7H12F2O5S/c1-2-3-4-6(10)14-5-7(8,9)15(11,12)13/h2-5H2,1H3,(H,11,12,13)/p-1 |
| InChIKey | MTKARAVXCQSIEO-UHFFFAOYSA-M |
| XLogP | 0.86 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.22 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|