C11H15F2O7S- — CID 58352325
1,1-difluoro-2-[5-(2-methylprop-2-enoyloxy)pentanoyloxy]ethanesulfonate (PubChem CID 58352325) has the molecular formula C11H15F2O7S- and a molecular weight of 329.30 g/mol. Its IUPAC name is 1,1-difluoro-2-[5-(2-methylprop-2-enoyloxy)pentanoyloxy]ethanesulfonate.
| Compound Name | 1,1-difluoro-2-[5-(2-methylprop-2-enoyloxy)pentanoyloxy]ethanesulfonate |
|---|---|
| PubChem CID | 58352325 |
| Molecular Formula | C11H15F2O7S- |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 1,1-difluoro-2-[5-(2-methylprop-2-enoyloxy)pentanoyloxy]ethanesulfonate |
| SMILES | C=C(C)C(=O)OCCCCC(=O)OCC(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C11H16F2O7S/c1-8(2)10(15)19-6-4-3-5-9(14)20-7-11(12,13)21(16,17)18/h1,3-7H2,2H3,(H,16,17,18)/p-1 |
| InChIKey | GYOFBMKXQTYOFP-UHFFFAOYSA-M |
| XLogP | 0.96 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|