C11H14F3O7S- — CID 58352339
1,1-difluoro-2-[6-(2-fluoroprop-2-enoyloxy)hexanoyloxy]ethanesulfonate (PubChem CID 58352339) has the molecular formula C11H14F3O7S- and a molecular weight of 347.29 g/mol. Its IUPAC name is 1,1-difluoro-2-[6-(2-fluoroprop-2-enoyloxy)hexanoyloxy]ethanesulfonate.
| Compound Name | 1,1-difluoro-2-[6-(2-fluoroprop-2-enoyloxy)hexanoyloxy]ethanesulfonate |
|---|---|
| PubChem CID | 58352339 |
| Molecular Formula | C11H14F3O7S- |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 1,1-difluoro-2-[6-(2-fluoroprop-2-enoyloxy)hexanoyloxy]ethanesulfonate |
| SMILES | C=C(F)C(=O)OCCCCCC(=O)OCC(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C11H15F3O7S/c1-8(12)10(16)20-6-4-2-3-5-9(15)21-7-11(13,14)22(17,18)19/h1-7H2,(H,17,18,19)/p-1 |
| InChIKey | PSEYYZXNHRYDCF-UHFFFAOYSA-M |
| XLogP | 1.25 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|