C5H4ClF3O4S — CID 123215032
(2-chlorosulfonyl-2,2-difluoroethyl) 2-fluoroprop-2-enoate (PubChem CID 123215032) has the molecular formula C5H4ClF3O4S and a molecular weight of 252.60 g/mol. Its IUPAC name is (2-chlorosulfonyl-2,2-difluoroethyl) 2-fluoroprop-2-enoate.
| Compound Name | (2-chlorosulfonyl-2,2-difluoroethyl) 2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 123215032 |
| Molecular Formula | C5H4ClF3O4S |
| Molecular Weight | 252.60 g/mol |
| Exact Mass | 251.95 |
| IUPAC Name | (2-chlorosulfonyl-2,2-difluoroethyl) 2-fluoroprop-2-enoate |
| SMILES | C=C(F)C(=O)OCC(F)(F)S(=O)(=O)Cl |
| InChI | InChI=1S/C5H4ClF3O4S/c1-3(7)4(10)13-2-5(8,9)14(6,11)12/h1-2H2 |
| InChIKey | GNRZGRJMHHSZTA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.60 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|