C10H12F3O7S- — CID 58352359
1,1-difluoro-2-[3-(2-fluoroprop-2-enoyloxy)-3-methylbutanoyl]oxyethanesulfonate (PubChem CID 58352359) has the molecular formula C10H12F3O7S- and a molecular weight of 333.26 g/mol. Its IUPAC name is 1,1-difluoro-2-[3-(2-fluoroprop-2-enoyloxy)-3-methylbutanoyl]oxyethanesulfonate.
| Compound Name | 1,1-difluoro-2-[3-(2-fluoroprop-2-enoyloxy)-3-methylbutanoyl]oxyethanesulfonate |
|---|---|
| PubChem CID | 58352359 |
| Molecular Formula | C10H12F3O7S- |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 1,1-difluoro-2-[3-(2-fluoroprop-2-enoyloxy)-3-methylbutanoyl]oxyethanesulfonate |
| SMILES | C=C(F)C(=O)OC(C)(C)CC(=O)OCC(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C10H13F3O7S/c1-6(11)8(15)20-9(2,3)4-7(14)19-5-10(12,13)21(16,17)18/h1,4-5H2,2-3H3,(H,16,17,18)/p-1 |
| InChIKey | HTBQDXDZQWVTTJ-UHFFFAOYSA-M |
| XLogP | 0.86 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|