C9H12F2O7S — CID 58352344
1,1-difluoro-2-[3-(2-methylprop-2-enoyloxy)propanoyloxy]ethanesulfonic acid (PubChem CID 58352344) has the molecular formula C9H12F2O7S and a molecular weight of 302.25 g/mol. Its IUPAC name is 1,1-difluoro-2-[3-(2-methylprop-2-enoyloxy)propanoyloxy]ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[3-(2-methylprop-2-enoyloxy)propanoyloxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 58352344 |
| Molecular Formula | C9H12F2O7S |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 1,1-difluoro-2-[3-(2-methylprop-2-enoyloxy)propanoyloxy]ethanesulfonic acid |
| SMILES | C=C(C)C(=O)OCCC(=O)OCC(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C9H12F2O7S/c1-6(2)8(13)17-4-3-7(12)18-5-9(10,11)19(14,15)16/h1,3-5H2,2H3,(H,14,15,16) |
| InChIKey | DNHBUINYARGRLE-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|