C9H13F2O7S+ — CID 163431506
[1-(2,2-difluoro-2-sulfoethoxy)-2-(2-methylprop-2-enoyloxy)propylidene]oxidanium (PubChem CID 163431506) has the molecular formula C9H13F2O7S+ and a molecular weight of 303.26 g/mol. Its IUPAC name is [1-(2,2-difluoro-2-sulfoethoxy)-2-(2-methylprop-2-enoyloxy)propylidene]oxidanium.
| Compound Name | [1-(2,2-difluoro-2-sulfoethoxy)-2-(2-methylprop-2-enoyloxy)propylidene]oxidanium |
|---|---|
| PubChem CID | 163431506 |
| Molecular Formula | C9H13F2O7S+ |
| Molecular Weight | 303.26 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | [1-(2,2-difluoro-2-sulfoethoxy)-2-(2-methylprop-2-enoyloxy)propylidene]oxidanium |
| SMILES | [H]/[O+]=C(/OCC(F)(F)S(=O)(=O)O)C(C)OC(=O)C(=C)C |
| InChI | InChI=1S/C9H12F2O7S/c1-5(2)7(12)18-6(3)8(13)17-4-9(10,11)19(14,15)16/h6H,1,4H2,2-3H3,(H,14,15,16)/p+1 |
| InChIKey | AQWDAPWLSUKZTB-UHFFFAOYSA-O |
| XLogP | 0.49 |
| TPSA | 111.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.26 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|