About 2-(2-acetyloxyacetyl)oxy-1,1-difluoroethanesulfonic acid
2-(2-acetyloxyacetyl)oxy-1,1-difluoroethanesulfonic acid (PubChem CID 129070607) has the molecular formula C6H8F2O7S
and a molecular weight of 262.19 g/mol. Its IUPAC name is 2-(2-acetyloxyacetyl)oxy-1,1-difluoroethanesulfonic acid.
Molecular Properties
| Compound Name | 2-(2-acetyloxyacetyl)oxy-1,1-difluoroethanesulfonic acid |
| PubChem CID | 129070607 |
| Molecular Formula | C6H8F2O7S |
| Molecular Weight | 262.19 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 2-(2-acetyloxyacetyl)oxy-1,1-difluoroethanesulfonic acid |
| SMILES | CC(=O)OCC(=O)OCC(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C6H8F2O7S/c1-4(9)14-2-5(10)15-3-6(7,8)16(11,12)13/h2-3H2,1H3,(H,11,12,13) |
| InChIKey | LUQFLVGIXRWQCI-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.19 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-acetyloxyacetyl)oxy-1,1-difluoroethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-acetyloxyacetyl)oxy-1,1-difluoroethanesulfonic acid?
The IUPAC name of 2-(2-acetyloxyacetyl)oxy-1,1-difluoroethanesulfonic acid (CID 129070607) is 2-(2-acetyloxyacetyl)oxy-1,1-difluoroethanesulfonic acid.
What is the SMILES notation for 2-(2-acetyloxyacetyl)oxy-1,1-difluoroethanesulfonic acid?
The canonical SMILES for 2-(2-acetyloxyacetyl)oxy-1,1-difluoroethanesulfonic acid is CC(=O)OCC(=O)OCC(F)(F)S(=O)(=O)O.
What is the InChIKey of 2-(2-acetyloxyacetyl)oxy-1,1-difluoroethanesulfonic acid?
The InChIKey is LUQFLVGIXRWQCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F2O7S/c1-4(9)14-2-5(10)15-3-6(7,8)16(11,12)13/h2-3H2,1H3,(H,11,12,13).
What are the key properties of 2-(2-acetyloxyacetyl)oxy-1,1-difluoroethanesulfonic acid?
2-(2-acetyloxyacetyl)oxy-1,1-difluoroethanesulfonic acid has a molecular weight of 262.19 g/mol, XLogP of -0.43, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-acetyloxyacetyl)oxy-1,1-difluoroethanesulfonic acid is sourced from PubChem (CID 129070607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).