C6H8F2O7S — CID 129070607
2-(2-acetyloxyacetyl)oxy-1,1-difluoroethanesulfonic acid (PubChem CID 129070607) has the molecular formula C6H8F2O7S and a molecular weight of 262.19 g/mol. Its IUPAC name is 2-(2-acetyloxyacetyl)oxy-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-(2-acetyloxyacetyl)oxy-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 129070607 |
| Molecular Formula | C6H8F2O7S |
| Molecular Weight | 262.19 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 2-(2-acetyloxyacetyl)oxy-1,1-difluoroethanesulfonic acid |
| SMILES | CC(=O)OCC(=O)OCC(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C6H8F2O7S/c1-4(9)14-2-5(10)15-3-6(7,8)16(11,12)13/h2-3H2,1H3,(H,11,12,13) |
| InChIKey | LUQFLVGIXRWQCI-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.19 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|