C9H14F2O6S — CID 58091899
2-(2-cyclopentyloxyacetyl)oxy-1,1-difluoroethanesulfonic acid (PubChem CID 58091899) has the molecular formula C9H14F2O6S and a molecular weight of 288.27 g/mol. Its IUPAC name is 2-(2-cyclopentyloxyacetyl)oxy-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-(2-cyclopentyloxyacetyl)oxy-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 58091899 |
| Molecular Formula | C9H14F2O6S |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 2-(2-cyclopentyloxyacetyl)oxy-1,1-difluoroethanesulfonic acid |
| SMILES | O=C(COC1CCCC1)OCC(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C9H14F2O6S/c10-9(11,18(13,14)15)6-17-8(12)5-16-7-3-1-2-4-7/h7H,1-6H2,(H,13,14,15) |
| InChIKey | HKVILTIRKRBJDY-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|