C13H20F2O7S — CID 58091873
2-[4-(cyclohexanecarbonyloxy)butanoyloxy]-1,1-difluoroethanesulfonic acid (PubChem CID 58091873) has the molecular formula C13H20F2O7S and a molecular weight of 358.36 g/mol. Its IUPAC name is 2-[4-(cyclohexanecarbonyloxy)butanoyloxy]-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-[4-(cyclohexanecarbonyloxy)butanoyloxy]-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 58091873 |
| Molecular Formula | C13H20F2O7S |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 2-[4-(cyclohexanecarbonyloxy)butanoyloxy]-1,1-difluoroethanesulfonic acid |
| SMILES | O=C(CCCOC(=O)C1CCCCC1)OCC(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C13H20F2O7S/c14-13(15,23(18,19)20)9-22-11(16)7-4-8-21-12(17)10-5-2-1-3-6-10/h10H,1-9H2,(H,18,19,20) |
| InChIKey | NXBKICFLFXOSBR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|