C17H28F4O6S — CID 176875263
5-[4-(cyclohexanecarbonyloxy)-2-methylbutan-2-yl]oxy-1,1,2,2-tetrafluoropentane-1-sulfonic acid (PubChem CID 176875263) has the molecular formula C17H28F4O6S and a molecular weight of 436.46 g/mol. Its IUPAC name is 5-[4-(cyclohexanecarbonyloxy)-2-methylbutan-2-yl]oxy-1,1,2,2-tetrafluoropentane-1-sulfonic acid.
| Compound Name | 5-[4-(cyclohexanecarbonyloxy)-2-methylbutan-2-yl]oxy-1,1,2,2-tetrafluoropentane-1-sulfonic acid |
|---|---|
| PubChem CID | 176875263 |
| Molecular Formula | C17H28F4O6S |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 5-[4-(cyclohexanecarbonyloxy)-2-methylbutan-2-yl]oxy-1,1,2,2-tetrafluoropentane-1-sulfonic acid |
| SMILES | CC(C)(CCOC(=O)C1CCCCC1)OCCCC(F)(F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C17H28F4O6S/c1-15(2,10-12-26-14(22)13-7-4-3-5-8-13)27-11-6-9-16(18,19)17(20,21)28(23,24)25/h13H,3-12H2,1-2H3,(H,23,24,25) |
| InChIKey | XZVIYZOXZXLIHO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|