C8H12F4O5S — CID 164777532
1,1,2,2-tetrafluoro-5-(oxiran-2-ylmethoxy)pentane-1-sulfonic acid (PubChem CID 164777532) has the molecular formula C8H12F4O5S and a molecular weight of 296.24 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-5-(oxiran-2-ylmethoxy)pentane-1-sulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-5-(oxiran-2-ylmethoxy)pentane-1-sulfonic acid |
|---|---|
| PubChem CID | 164777532 |
| Molecular Formula | C8H12F4O5S |
| Molecular Weight | 296.24 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 1,1,2,2-tetrafluoro-5-(oxiran-2-ylmethoxy)pentane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)CCCOCC1CO1 |
| InChI | InChI=1S/C8H12F4O5S/c9-7(10,8(11,12)18(13,14)15)2-1-3-16-4-6-5-17-6/h6H,1-5H2,(H,13,14,15) |
| InChIKey | XRCAAVLXYOYTDL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|