C8H11F5O2 — CID 98041590
(2S)-2-(4,4,5,5,5-pentafluoropentoxymethyl)oxirane (PubChem CID 98041590) has the molecular formula C8H11F5O2 and a molecular weight of 234.16 g/mol. Its IUPAC name is (2S)-2-(4,4,5,5,5-pentafluoropentoxymethyl)oxirane.
| Compound Name | (2S)-2-(4,4,5,5,5-pentafluoropentoxymethyl)oxirane |
|---|---|
| PubChem CID | 98041590 |
| Molecular Formula | C8H11F5O2 |
| Molecular Weight | 234.16 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | (2S)-2-(4,4,5,5,5-pentafluoropentoxymethyl)oxirane |
| SMILES | FC(F)(F)C(F)(F)CCCOC[C@@H]1CO1 |
| InChI | InChI=1S/C8H11F5O2/c9-7(10,8(11,12)13)2-1-3-14-4-6-5-15-6/h6H,1-5H2/t6-/m1/s1 |
| InChIKey | GFPZCNPMTKHOJZ-ZCFIWIBFSA-N |
| XLogP | 2.38 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.16 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|