C29H52O8 — CID 150577624
2-[[9-(oxiran-2-ylmethoxy)-5,5-bis[4-(oxiran-2-ylmethoxy)butyl]nonoxy]methyl]oxirane (PubChem CID 150577624) has the molecular formula C29H52O8 and a molecular weight of 528.73 g/mol. Its IUPAC name is 2-[[9-(oxiran-2-ylmethoxy)-5,5-bis[4-(oxiran-2-ylmethoxy)butyl]nonoxy]methyl]oxirane.
| Compound Name | 2-[[9-(oxiran-2-ylmethoxy)-5,5-bis[4-(oxiran-2-ylmethoxy)butyl]nonoxy]methyl]oxirane |
|---|---|
| PubChem CID | 150577624 |
| Molecular Formula | C29H52O8 |
| Molecular Weight | 528.73 g/mol |
| Exact Mass | 528.37 |
| IUPAC Name | 2-[[9-(oxiran-2-ylmethoxy)-5,5-bis[4-(oxiran-2-ylmethoxy)butyl]nonoxy]methyl]oxirane |
| SMILES | C(CCC(CCCCOCC1CO1)(CCCCOCC1CO1)CCCCOCC1CO1)COCC1CO1 |
| InChI | InChI=1S/C29H52O8/c1(5-13-30-17-25-21-34-25)9-29(10-2-6-14-31-18-26-22-35-26,11-3-7-15-32-19-27-23-36-27)12-4-8-16-33-20-28-24-37-28/h25-28H,1-24H2 |
| InChIKey | INDOAZOWKBTASQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 87.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.73 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|