About 2-methyl-6-(oxiran-2-ylmethoxy)hexan-2-ol;zirconium
2-methyl-6-(oxiran-2-ylmethoxy)hexan-2-ol;zirconium (PubChem CID 87744459) has the molecular formula C10H20O3Zr
and a molecular weight of 279.49 g/mol. Its IUPAC name is 2-methyl-6-(oxiran-2-ylmethoxy)hexan-2-ol;zirconium.
Molecular Properties
| Compound Name | 2-methyl-6-(oxiran-2-ylmethoxy)hexan-2-ol;zirconium |
| PubChem CID | 87744459 |
| Molecular Formula | C10H20O3Zr |
| Molecular Weight | 279.49 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 2-methyl-6-(oxiran-2-ylmethoxy)hexan-2-ol;zirconium |
| SMILES | CC(C)(O)CCCCOCC1CO1.[Zr] |
| InChI | InChI=1S/C10H20O3.Zr/c1-10(2,11)5-3-4-6-12-7-9-8-13-9;/h9,11H,3-8H2,1-2H3; |
| InChIKey | VBGAKMMMWGUXTG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.49 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-6-(oxiran-2-ylmethoxy)hexan-2-ol;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-(oxiran-2-ylmethoxy)hexan-2-ol;zirconium?
The IUPAC name of 2-methyl-6-(oxiran-2-ylmethoxy)hexan-2-ol;zirconium (CID 87744459) is 2-methyl-6-(oxiran-2-ylmethoxy)hexan-2-ol;zirconium.
What is the SMILES notation for 2-methyl-6-(oxiran-2-ylmethoxy)hexan-2-ol;zirconium?
The canonical SMILES for 2-methyl-6-(oxiran-2-ylmethoxy)hexan-2-ol;zirconium is CC(C)(O)CCCCOCC1CO1.[Zr].
What is the InChIKey of 2-methyl-6-(oxiran-2-ylmethoxy)hexan-2-ol;zirconium?
The InChIKey is VBGAKMMMWGUXTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O3.Zr/c1-10(2,11)5-3-4-6-12-7-9-8-13-9;/h9,11H,3-8H2,1-2H3;.
What are the key properties of 2-methyl-6-(oxiran-2-ylmethoxy)hexan-2-ol;zirconium?
2-methyl-6-(oxiran-2-ylmethoxy)hexan-2-ol;zirconium has a molecular weight of 279.49 g/mol, XLogP of 1.34, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-(oxiran-2-ylmethoxy)hexan-2-ol;zirconium is sourced from PubChem (CID 87744459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).