C9H15F3NO7S2- — CID 164777413
3-[2-(oxiran-2-ylmethoxy)ethoxy]propylsulfonyl-(trifluoromethylsulfonyl)azanide (PubChem CID 164777413) has the molecular formula C9H15F3NO7S2- and a molecular weight of 370.35 g/mol. Its IUPAC name is 3-[2-(oxiran-2-ylmethoxy)ethoxy]propylsulfonyl-(trifluoromethylsulfonyl)azanide.
| Compound Name | 3-[2-(oxiran-2-ylmethoxy)ethoxy]propylsulfonyl-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 164777413 |
| Molecular Formula | C9H15F3NO7S2- |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 3-[2-(oxiran-2-ylmethoxy)ethoxy]propylsulfonyl-(trifluoromethylsulfonyl)azanide |
| SMILES | O=S(=O)(CCCOCCOCC1CO1)[N-]S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H15F3NO7S2/c10-9(11,12)22(16,17)13-21(14,15)5-1-2-18-3-4-19-6-8-7-20-8/h8H,1-7H2/q-1 |
| InChIKey | VAKVTUBJNLWDHJ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 113.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|