C5H6F4O5S — CID 22568726
1,1,2,2-tetrafluoro-2-(oxiran-2-ylmethoxy)ethanesulfonic acid (PubChem CID 22568726) has the molecular formula C5H6F4O5S and a molecular weight of 254.16 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-(oxiran-2-ylmethoxy)ethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-(oxiran-2-ylmethoxy)ethanesulfonic acid |
|---|---|
| PubChem CID | 22568726 |
| Molecular Formula | C5H6F4O5S |
| Molecular Weight | 254.16 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-(oxiran-2-ylmethoxy)ethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)OCC1CO1 |
| InChI | InChI=1S/C5H6F4O5S/c6-4(7,14-2-3-1-13-3)5(8,9)15(10,11)12/h3H,1-2H2,(H,10,11,12) |
| InChIKey | BFEHUCFYRNJFLO-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.16 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|