C5H8F4O6S — CID 19938693
2-(3,3-dihydroxypropoxy)-1,1,2,2-tetrafluoroethanesulfonic acid (PubChem CID 19938693) has the molecular formula C5H8F4O6S and a molecular weight of 272.17 g/mol. Its IUPAC name is 2-(3,3-dihydroxypropoxy)-1,1,2,2-tetrafluoroethanesulfonic acid.
| Compound Name | 2-(3,3-dihydroxypropoxy)-1,1,2,2-tetrafluoroethanesulfonic acid |
|---|---|
| PubChem CID | 19938693 |
| Molecular Formula | C5H8F4O6S |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 2-(3,3-dihydroxypropoxy)-1,1,2,2-tetrafluoroethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)OCCC(O)O |
| InChI | InChI=1S/C5H8F4O6S/c6-4(7,15-2-1-3(10)11)5(8,9)16(12,13)14/h3,10-11H,1-2H2,(H,12,13,14) |
| InChIKey | GXYPGGRTUJUTIL-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|