C24H26F24O15S3 — CID 58616442
2-[5-[2,3-bis[4,4,5,5-tetrafluoro-5-(1,1,2,2-tetrafluoro-2-sulfoethoxy)pentoxy]propoxy]-1,1,2,2-tetrafluoropentoxy]-1,1,2,2-tetrafluoroethanesulfonic acid (PubChem CID 58616442) has the molecular formula C24H26F24O15S3 and a molecular weight of 1106.61 g/mol. Its IUPAC name is 2-[5-[2,3-bis[4,4,5,5-tetrafluoro-5-(1,1,2,2-tetrafluoro-2-sulfoethoxy)pentoxy]propoxy]-1,1,2,2-tetrafluoropentoxy]-1,1,2,2-tetrafluoroethanesulfonic acid.
| Compound Name | 2-[5-[2,3-bis[4,4,5,5-tetrafluoro-5-(1,1,2,2-tetrafluoro-2-sulfoethoxy)pentoxy]propoxy]-1,1,2,2-tetrafluoropentoxy]-1,1,2,2-tetrafluoroethanesulfonic acid |
|---|---|
| PubChem CID | 58616442 |
| Molecular Formula | C24H26F24O15S3 |
| Molecular Weight | 1106.61 g/mol |
| Exact Mass | 1106.01 |
| IUPAC Name | 2-[5-[2,3-bis[4,4,5,5-tetrafluoro-5-(1,1,2,2-tetrafluoro-2-sulfoethoxy)pentoxy]propoxy]-1,1,2,2-tetrafluoropentoxy]-1,1,2,2-tetrafluoroethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)CCCOCC(COCCCC(F)(F)C(F)(F)OC(F)(F)C(F)(F)S(=O)(=O)O)OCCCC(F)(F)C(F)(F)OC(F)(F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C24H26F24O15S3/c25-13(26,16(31,32)61-19(37,38)22(43,44)64(49,50)51)4-1-7-58-10-12(60-9-3-6-15(29,30)18(35,36)63-21(41,42)24(47,48)66(55,56)57)11-59-8-2-5-14(27,28)17(33,34)62-20(39,40)23(45,46)65(52,53)54/h12H,1-11H2,(H,49,50,51)(H,52,53,54)(H,55,56,57) |
| InChIKey | LDEHLDUONVLQJY-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 218.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1106.61 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|