C11H12F8O6S — CID 59482609
1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-5-(2-methylprop-2-enoyloxy)pentoxy]ethanesulfonic acid (PubChem CID 59482609) has the molecular formula C11H12F8O6S and a molecular weight of 424.26 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-5-(2-methylprop-2-enoyloxy)pentoxy]ethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-5-(2-methylprop-2-enoyloxy)pentoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 59482609 |
| Molecular Formula | C11H12F8O6S |
| Molecular Weight | 424.26 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-5-(2-methylprop-2-enoyloxy)pentoxy]ethanesulfonic acid |
| SMILES | C=C(C)C(=O)OCCCC(F)(F)C(F)(F)OC(F)(F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C11H12F8O6S/c1-6(2)7(20)24-5-3-4-8(12,13)9(14,15)25-10(16,17)11(18,19)26(21,22)23/h1,3-5H2,2H3,(H,21,22,23) |
| InChIKey | LJTSPYXBSHYKMM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.26 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|