C21H26F8O14S — CID 89140566
1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-5-[(2R,4R,5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxypentoxy]ethanesulfonic acid (PubChem CID 89140566) has the molecular formula C21H26F8O14S and a molecular weight of 686.48 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-5-[(2R,4R,5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxypentoxy]ethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-5-[(2R,4R,5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxypentoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 89140566 |
| Molecular Formula | C21H26F8O14S |
| Molecular Weight | 686.48 g/mol |
| Exact Mass | 686.09 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-5-[(2R,4R,5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxypentoxy]ethanesulfonic acid |
| SMILES | CC(=O)OCC1O[C@@H](OCCCC(F)(F)C(F)(F)OC(F)(F)C(F)(F)S(=O)(=O)O)C(OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H26F8O14S/c1-9(30)38-8-13-14(39-10(2)31)15(40-11(3)32)16(41-12(4)33)17(42-13)37-7-5-6-18(22,23)19(24,25)43-20(26,27)21(28,29)44(34,35)36/h13-17H,5-8H2,1-4H3,(H,34,35,36)/t13?,14-,15-,16?,17-/m1/s1 |
| InChIKey | GDYAOCYUSJOMBO-VYKNEJCXSA-N |
| XLogP | 2.18 |
| TPSA | 187.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|