C21H27F8NO13S — CID 87527832
[(3R,4S,6R)-3,4,5-triacetyloxy-6-[4,4,5,5-tetrafluoro-5-(1,1,2,2-tetrafluoro-2-sulfamoylethoxy)pentoxy]oxan-2-yl]methyl acetate (PubChem CID 87527832) has the molecular formula C21H27F8NO13S and a molecular weight of 685.49 g/mol. Its IUPAC name is [(3R,4S,6R)-3,4,5-triacetyloxy-6-[4,4,5,5-tetrafluoro-5-(1,1,2,2-tetrafluoro-2-sulfamoylethoxy)pentoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(3R,4S,6R)-3,4,5-triacetyloxy-6-[4,4,5,5-tetrafluoro-5-(1,1,2,2-tetrafluoro-2-sulfamoylethoxy)pentoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 87527832 |
| Molecular Formula | C21H27F8NO13S |
| Molecular Weight | 685.49 g/mol |
| Exact Mass | 685.11 |
| IUPAC Name | [(3R,4S,6R)-3,4,5-triacetyloxy-6-[4,4,5,5-tetrafluoro-5-(1,1,2,2-tetrafluoro-2-sulfamoylethoxy)pentoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](OCCCC(F)(F)C(F)(F)OC(F)(F)C(F)(F)S(N)(=O)=O)C(OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H27F8NO13S/c1-9(31)38-8-13-14(39-10(2)32)15(40-11(3)33)16(41-12(4)34)17(42-13)37-7-5-6-18(22,23)19(24,25)43-20(26,27)21(28,29)44(30,35)36/h13-17H,5-8H2,1-4H3,(H2,30,35,36)/t13?,14-,15+,16?,17-/m1/s1 |
| InChIKey | FAAZTDLDQXHUCD-QFDKOSDTSA-N |
| XLogP | 1.59 |
| TPSA | 193.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.49 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|