C11H20O6S — CID 152500122
1-hydroxy-3-methyl-6-(2-methylprop-2-enoyloxy)hexane-3-sulfonic acid (PubChem CID 152500122) has the molecular formula C11H20O6S and a molecular weight of 280.34 g/mol. Its IUPAC name is 1-hydroxy-3-methyl-6-(2-methylprop-2-enoyloxy)hexane-3-sulfonic acid.
| Compound Name | 1-hydroxy-3-methyl-6-(2-methylprop-2-enoyloxy)hexane-3-sulfonic acid |
|---|---|
| PubChem CID | 152500122 |
| Molecular Formula | C11H20O6S |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 1-hydroxy-3-methyl-6-(2-methylprop-2-enoyloxy)hexane-3-sulfonic acid |
| SMILES | C=C(C)C(=O)OCCCC(C)(CCO)S(=O)(=O)O |
| InChI | InChI=1S/C11H20O6S/c1-9(2)10(13)17-8-4-5-11(3,6-7-12)18(14,15)16/h12H,1,4-8H2,2-3H3,(H,14,15,16) |
| InChIKey | YDHCXYSACZGJFI-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|