C9H11F4O5S- — CID 59524685
[1,1,2,2-tetrafluoro-5-(2-methylprop-2-enoyloxy)pentyl] sulfite (PubChem CID 59524685) has the molecular formula C9H11F4O5S- and a molecular weight of 307.24 g/mol. Its IUPAC name is [1,1,2,2-tetrafluoro-5-(2-methylprop-2-enoyloxy)pentyl] sulfite.
| Compound Name | [1,1,2,2-tetrafluoro-5-(2-methylprop-2-enoyloxy)pentyl] sulfite |
|---|---|
| PubChem CID | 59524685 |
| Molecular Formula | C9H11F4O5S- |
| Molecular Weight | 307.24 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | [1,1,2,2-tetrafluoro-5-(2-methylprop-2-enoyloxy)pentyl] sulfite |
| SMILES | C=C(C)C(=O)OCCCC(F)(F)C(F)(F)OS(=O)[O-] |
| InChI | InChI=1S/C9H12F4O5S/c1-6(2)7(14)17-5-3-4-8(10,11)9(12,13)18-19(15)16/h1,3-5H2,2H3,(H,15,16)/p-1 |
| InChIKey | MWOGQFZCUUUBPZ-UHFFFAOYSA-M |
| XLogP | 1.92 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|