C13H10F14O5 — CID 161443281
[2,2,3,3-tetrafluoro-3-[1,1,2,2,3,3-hexafluoro-3-(1,1,2,2-tetrafluoro-2-methoxyethoxy)propoxy]propyl] 2-methylprop-2-enoate (PubChem CID 161443281) has the molecular formula C13H10F14O5 and a molecular weight of 512.19 g/mol. Its IUPAC name is [2,2,3,3-tetrafluoro-3-[1,1,2,2,3,3-hexafluoro-3-(1,1,2,2-tetrafluoro-2-methoxyethoxy)propoxy]propyl] 2-methylprop-2-enoate.
| Compound Name | [2,2,3,3-tetrafluoro-3-[1,1,2,2,3,3-hexafluoro-3-(1,1,2,2-tetrafluoro-2-methoxyethoxy)propoxy]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 161443281 |
| Molecular Formula | C13H10F14O5 |
| Molecular Weight | 512.19 g/mol |
| Exact Mass | 512.03 |
| IUPAC Name | [2,2,3,3-tetrafluoro-3-[1,1,2,2,3,3-hexafluoro-3-(1,1,2,2-tetrafluoro-2-methoxyethoxy)propoxy]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC |
| InChI | InChI=1S/C13H10F14O5/c1-5(2)6(28)30-4-7(14,15)9(18,19)31-10(20,21)8(16,17)11(22,23)32-13(26,27)12(24,25)29-3/h1,4H2,2-3H3 |
| InChIKey | TUOSEURYPPVKJC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.19 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|