C17H11F19O8 — CID 166849986
[3-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]acetyl]oxy-2-hydroxypropyl] 2-methylprop-2-enoate (PubChem CID 166849986) has the molecular formula C17H11F19O8 and a molecular weight of 704.23 g/mol. Its IUPAC name is [3-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]acetyl]oxy-2-hydroxypropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]acetyl]oxy-2-hydroxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 166849986 |
| Molecular Formula | C17H11F19O8 |
| Molecular Weight | 704.23 g/mol |
| Exact Mass | 704.02 |
| IUPAC Name | [3-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]acetyl]oxy-2-hydroxypropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COC(=O)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H11F19O8/c1-5(2)7(38)40-3-6(37)4-41-8(39)9(18,19)42-14(29,30)15(31,32)44-17(35,36)16(33,34)43-13(27,28)11(22,23)10(20,21)12(24,25)26/h6,37H,1,3-4H2,2H3 |
| InChIKey | DKGXILLKRKLKMM-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.23 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|