C14H18F8O4 — CID 89077221
(4,4,5,5,6,6,7,7-octafluoro-2,9-dihydroxydecyl) 2-methylprop-2-enoate (PubChem CID 89077221) has the molecular formula C14H18F8O4 and a molecular weight of 402.28 g/mol. Its IUPAC name is (4,4,5,5,6,6,7,7-octafluoro-2,9-dihydroxydecyl) 2-methylprop-2-enoate.
| Compound Name | (4,4,5,5,6,6,7,7-octafluoro-2,9-dihydroxydecyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89077221 |
| Molecular Formula | C14H18F8O4 |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | (4,4,5,5,6,6,7,7-octafluoro-2,9-dihydroxydecyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)CC(C)O |
| InChI | InChI=1S/C14H18F8O4/c1-7(2)10(25)26-6-9(24)5-12(17,18)14(21,22)13(19,20)11(15,16)4-8(3)23/h8-9,23-24H,1,4-6H2,2-3H3 |
| InChIKey | XHZLQIYNMWAXEC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|