C16H22F4O6 — CID 21187250
[4,4,5,5-tetrafluoro-2,8-dihydroxy-7-(2-methylprop-2-enoyloxy)octyl] 2-methylprop-2-enoate (PubChem CID 21187250) has the molecular formula C16H22F4O6 and a molecular weight of 386.34 g/mol. Its IUPAC name is [4,4,5,5-tetrafluoro-2,8-dihydroxy-7-(2-methylprop-2-enoyloxy)octyl] 2-methylprop-2-enoate.
| Compound Name | [4,4,5,5-tetrafluoro-2,8-dihydroxy-7-(2-methylprop-2-enoyloxy)octyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 21187250 |
| Molecular Formula | C16H22F4O6 |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | [4,4,5,5-tetrafluoro-2,8-dihydroxy-7-(2-methylprop-2-enoyloxy)octyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)CC(F)(F)C(F)(F)CC(CO)OC(=O)C(=C)C |
| InChI | InChI=1S/C16H22F4O6/c1-9(2)13(23)25-8-11(22)5-15(17,18)16(19,20)6-12(7-21)26-14(24)10(3)4/h11-12,21-22H,1,3,5-8H2,2,4H3 |
| InChIKey | HFPKNNKBQZOWRB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|