C15H12F16O3 — CID 139918567
(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-hexadecafluoro-2-hydroxyundecyl) 2-methylprop-2-enoate (PubChem CID 139918567) has the molecular formula C15H12F16O3 and a molecular weight of 544.23 g/mol. Its IUPAC name is (4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-hexadecafluoro-2-hydroxyundecyl) 2-methylprop-2-enoate.
| Compound Name | (4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-hexadecafluoro-2-hydroxyundecyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139918567 |
| Molecular Formula | C15H12F16O3 |
| Molecular Weight | 544.23 g/mol |
| Exact Mass | 544.05 |
| IUPAC Name | (4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-hexadecafluoro-2-hydroxyundecyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C15H12F16O3/c1-5(2)7(33)34-4-6(32)3-9(18,19)11(22,23)13(26,27)15(30,31)14(28,29)12(24,25)10(20,21)8(16)17/h6,8,32H,1,3-4H2,2H3 |
| InChIKey | FOFPSBCQDCOIEC-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.23 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|