C13H12F12O3S — CID 151627083
(4,4,5,5,6,6,7,7,8,9,9,9-dodecafluoro-2-hydroxy-8-sulfanylnonyl) 2-methylprop-2-enoate (PubChem CID 151627083) has the molecular formula C13H12F12O3S and a molecular weight of 476.28 g/mol. Its IUPAC name is (4,4,5,5,6,6,7,7,8,9,9,9-dodecafluoro-2-hydroxy-8-sulfanylnonyl) 2-methylprop-2-enoate.
| Compound Name | (4,4,5,5,6,6,7,7,8,9,9,9-dodecafluoro-2-hydroxy-8-sulfanylnonyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 151627083 |
| Molecular Formula | C13H12F12O3S |
| Molecular Weight | 476.28 g/mol |
| Exact Mass | 476.03 |
| IUPAC Name | (4,4,5,5,6,6,7,7,8,9,9,9-dodecafluoro-2-hydroxy-8-sulfanylnonyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(S)C(F)(F)F |
| InChI | InChI=1S/C13H12F12O3S/c1-5(2)7(27)28-4-6(26)3-8(14,15)9(16,17)10(18,19)11(20,21)12(22,29)13(23,24)25/h6,26,29H,1,3-4H2,2H3 |
| InChIKey | QPSPESFBGLSMRF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.28 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|