C13H8F16O3 — CID 87905801
[4,4,5,5,6,6,7,7,8,9,9,9-dodecafluoro-2-hydroxy-8-(trifluoromethyl)nonyl] 2-fluoroprop-2-enoate (PubChem CID 87905801) has the molecular formula C13H8F16O3 and a molecular weight of 516.17 g/mol. Its IUPAC name is [4,4,5,5,6,6,7,7,8,9,9,9-dodecafluoro-2-hydroxy-8-(trifluoromethyl)nonyl] 2-fluoroprop-2-enoate.
| Compound Name | [4,4,5,5,6,6,7,7,8,9,9,9-dodecafluoro-2-hydroxy-8-(trifluoromethyl)nonyl] 2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 87905801 |
| Molecular Formula | C13H8F16O3 |
| Molecular Weight | 516.17 g/mol |
| Exact Mass | 516.02 |
| IUPAC Name | [4,4,5,5,6,6,7,7,8,9,9,9-dodecafluoro-2-hydroxy-8-(trifluoromethyl)nonyl] 2-fluoroprop-2-enoate |
| SMILES | C=C(F)C(=O)OCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H8F16O3/c1-4(14)6(31)32-3-5(30)2-7(15,16)9(18,19)11(22,23)10(20,21)8(17,12(24,25)26)13(27,28)29/h5,30H,1-3H2 |
| InChIKey | XQMXMNBCVOAXBN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.17 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|