C16H13F17O6 — CID 158667997
4,4,5,5,6,6,7,7,8,9,9,9-dodecafluoro-8-(trifluoromethyl)nonane-1,2-diol;bis(2-fluoroprop-2-enoic acid) (PubChem CID 158667997) has the molecular formula C16H13F17O6 and a molecular weight of 624.24 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,8,9,9,9-dodecafluoro-8-(trifluoromethyl)nonane-1,2-diol;bis(2-fluoroprop-2-enoic acid).
| Compound Name | 4,4,5,5,6,6,7,7,8,9,9,9-dodecafluoro-8-(trifluoromethyl)nonane-1,2-diol;bis(2-fluoroprop-2-enoic acid) |
|---|---|
| PubChem CID | 158667997 |
| Molecular Formula | C16H13F17O6 |
| Molecular Weight | 624.24 g/mol |
| Exact Mass | 624.04 |
| IUPAC Name | 4,4,5,5,6,6,7,7,8,9,9,9-dodecafluoro-8-(trifluoromethyl)nonane-1,2-diol;bis(2-fluoroprop-2-enoic acid) |
| SMILES | C=C(F)C(=O)O.C=C(F)C(=O)O.OCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H7F15O2.2C3H3FO2/c11-4(12,1-3(27)2-26)6(14,15)8(18,19)7(16,17)5(13,9(20,21)22)10(23,24)25;2*1-2(4)3(5)6/h3,26-27H,1-2H2;2*1H2,(H,5,6) |
| InChIKey | IDPGMZGHZRGOOF-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.24 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|