C15H15F11O5 — CID 162063074
2-methylprop-2-enoic acid;[4,4,5,5,6,7,7,7-octafluoro-2-hydroxy-6-(trifluoromethyl)heptyl] prop-2-enoate (PubChem CID 162063074) has the molecular formula C15H15F11O5 and a molecular weight of 484.26 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;[4,4,5,5,6,7,7,7-octafluoro-2-hydroxy-6-(trifluoromethyl)heptyl] prop-2-enoate.
| Compound Name | 2-methylprop-2-enoic acid;[4,4,5,5,6,7,7,7-octafluoro-2-hydroxy-6-(trifluoromethyl)heptyl] prop-2-enoate |
|---|---|
| PubChem CID | 162063074 |
| Molecular Formula | C15H15F11O5 |
| Molecular Weight | 484.26 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | 2-methylprop-2-enoic acid;[4,4,5,5,6,7,7,7-octafluoro-2-hydroxy-6-(trifluoromethyl)heptyl] prop-2-enoate |
| SMILES | C=C(C)C(=O)O.C=CC(=O)OCC(O)CC(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H9F11O3.C4H6O2/c1-2-6(24)25-4-5(23)3-7(12,13)9(15,16)8(14,10(17,18)19)11(20,21)22;1-3(2)4(5)6/h2,5,23H,1,3-4H2;1H2,2H3,(H,5,6) |
| InChIKey | ZACDIBWUFJIZFW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.26 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|